
To find the IUPAC name of the given compound CH3-CH(OH)-CH2-CH(CH3)-CH3, we need to follow these steps:
Thus, the IUPAC name of the compound is 4-methyl pentane-2-ol, as it accounts for the methyl substituent at the fourth carbon and the alcohol group at the second carbon.
This correctly describes the structure of the compound: a five-carbon chain with a single hydroxyl group and a methyl group substituent in the appropriate positions.