Question:medium

IUPAC name of the compound CH\(_3\)-CH(OH)-CH\(_2\)-CH(CH\(_3\))-CH\(_3\) is

Show Hint

Numbering gives lowest number to -OH group.
Updated On: Jun 16, 2026
  • 4-methyl pentene-2-ol
  • 2-methyl pentanol-4
  • 4,4-dimethyl-butane-2-ol
  • 4-methyl pentane-2-ol
Show Solution

The Correct Option is D

Solution and Explanation

To find the IUPAC name of the given compound CH3-CH(OH)-CH2-CH(CH3)-CH3, we need to follow these steps:

  1. Identify the longest carbon chain containing the functional group. Here, the longest chain has 5 carbon atoms, making it a pentane derivative.
  2. Number the chain such that the functional group (-OH) gets the lowest possible number. The numbering starts from the end closest to the -OH group. Therefore, the -OH group is on the second carbon.
  3. Identify and number substituents. There is a methyl group (CH3) on the fourth carbon of the main chain.
  4. Combine these observations to name the compound. The substituent position and name come first, followed by the main chain and the position of the -OH group.

Thus, the IUPAC name of the compound is 4-methyl pentane-2-ol, as it accounts for the methyl substituent at the fourth carbon and the alcohol group at the second carbon.

This correctly describes the structure of the compound: a five-carbon chain with a single hydroxyl group and a methyl group substituent in the appropriate positions.

Was this answer helpful?
0