List of top Chemistry Questions on Organic Chemistry asked in NEET (UG)

The correct IUPAC name of the following compound is: \[ {CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH2-CH3} \]

Among the given compounds I-III, the correct order of bond dissociation energy of the C-H bond marked with is:
The correct order of decreasing acidity of the following aliphatic acids is:
The correct order of decreasing basic strength of the given amines is:
Which one of the following compounds can exist as cis-trans isomers?

Identify the suitable reagent for the following conversion: $Ph-C(=O)-OCH_3$ $\longrightarrow$ $Ph-CHO$

Predict the major product $ P $ in the following sequence of reactions:
(i) HBr, benzoyl peroxide 
(ii) KCN 
(iii) Na(Hg), $C_{2}H_{5}OH$

The major product of the following reaction is:
$Ph-C(=O)-CH_2CH_2-CN$
(i) $CH_{3}MgBr (excess) (ii) H_{+}H_{2}O$
Which one of the following compounds does not decolorize bromine water?
Given below are two statements:
Statement I: Benzendiazonium salt is prepared by the reaction of aniline with nitrous acid at 273-278 K. It decomposes easily in the dry state.
Statement II: Insertion of iodine into the benzene ring is difficult and hence iodobenzene is prepared through the reaction of benzendiazonium salt with KI.
In the light of the above statements, choose the most appropriate answer from the options given below:
Sugar ‘X’:
A. is found in honey.
B. is a keto sugar.
C. exists in $\alpha$ and $\beta$ anomeric forms.
D. is laevorotatory.
‘X’ is:
How many products (including stereoisomers) are expected from monochlorination of the following compound?
$CH_3-CH-CH_2-CH_3$
Given below are two statements: one is labelled as Assertion (A) and the other is labelled as Reason (R).
Assertion (A): I$^-$ undergoes SN$_2$ reaction faster than Cl$^-$.
Reason (R): Iodine is a better leaving group because of its large size.
In the light of the above statements, choose the correct answer from the options given below:
Which one of the following reactions does NOT give benzene as the product?
Which one of the following reactions does NOT belong to “Lassaigne's test”?
On complete combustion, 0.3 g of an organic compound gave 0.2 g of CO2 and 0.1 g of H2O. The percentage composition of carbon and hydrogen in the compound, respectively, is:
Methyl group attached to a positively charged carbon atom stabilizes the carbocation due to
Identify compound \(X\) in the following sequence of reactions :
Alternative_Text
The difference between amylose and amylopectin is
In the reaction
the electrophile involved is
the electrophile involved is
Which of the following is correct with respect to – I effect of the substituents ? (R = alkyl)
Identify the major products P, Q and R in the following sequence of reactions :
Chemical Reaction of structures
Reaction by which Benzaldehyde cannot be prepared
The structure of isobutyl group in an organic compound is
The radical Chemical Structure is aromatic because it has