List of top Chemistry Questions on Organic Chemistry asked in WBJEE

Arrange the following compounds in order of their increasing acid strength. 


Compound given below will produce effervescence when mixed with aqueous sodium bicarbonate solution 

Which of the following statement(s) is/are correct about the given compound?

Arrange the following compounds in order of their increasing acid strength

In the following reaction, the major product (H) is

Which of the following compounds is most reactive in S$_N$1 reaction?

Which one among the following compounds will most readily be dehydrated under acidic condition?
 

(A)(B)(C)(D)
CH3-CH2-CH2-OHCH3-CH(CH3)-CH2-OHCH3-CH2-CH(CH3)-OHC(CH3)(CH3)-CH2-OH
(1° alcohol)(2° alcohol)(2° alcohol)(3° alcohol)
In the following sequence of reactions, compound 'M' is:

\( \text{M} \xrightarrow{\text{CH}_3\text{MgBr}} \text{N} + \text{CH}_4 \uparrow \xrightarrow{\text{H}^+} \text{CH}_3\text{COCH}_2\text{COCH}_3 \)

The correct acidity order of phenol (I), 4-hydroxybenzaldehyde (II), and 3-hydroxybenzaldehyde (III) is:

Which of the following statement(s) is/are correct about the given compound?